Learn More
2',7'-Dichlorofluorescein, pure, ACROS Organics™
Brand: Acros Organics 191530050
Additional Details : CAS Number : 76-54-0 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 76-54-0 | |
| 401.195 | |
| VFNKZQNIXUFLBC-UHFFFAOYSA-N | |
| 64944 | |
| 2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| C20H10Cl2O5 | |
| MFCD00005047 | |
| 2',7'-Dichloro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one | |
| CHEBI:51596 | |
| C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl |
Specifications
| 2', 7'-Dichlorofluorescein | |
| C20H10Cl2O5 | |
| 19, V,6, 461 | |
| 2',7'-Dichloro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one | |
| VFNKZQNIXUFLBC-UHFFFAOYSA-N | |
| 2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one | |
| 5% max. (110°C) | |
| 64944 | |
| 401.2 | |
| Extra Pure | |
| 2000 (at lambda min.) | |
| Brown-Red to Orange |
| 76-54-0 | |
| MFCD00005047 | |
| 15, 3076 | |
| Authentic | |
| C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl | |
| 501 to 503nm (in 0.1N NaOH) | |
| 401.195 | |
| CHEBI:51596 | |
| Powder | |
| Glass bottle | |
| 0.79g/mL | |
| 5g |