Learn More
3-Aminophenylboronic acid hydrochloride, 98%, ACROS Organics™
Brand: Acros Organics 435530050
Additional Details : CAS Number : 85006-23-1 Weight : 0.05500kg
| Quantity | 5g |
|---|
Chemical Identifiers
| 85006-23-1 | |
| 173.40 | |
| QBMHZZHJIBUPOX-UHFFFAOYSA-N | |
| 2763241 | |
| [H+].[Cl-].NC1=CC=CC(=C1)B(O)O |
| C6H9BClNO2 | |
| MFCD00191748 | |
| 3-aminophenyl boronic acid hydrochloride, 3-aminophenylboronic acid hydrochloride, 3-aminophenylboronic acid hcl, m-aminophenylboronic acid hydrochloride, 3-aminophenylboronic acid, hcl, 3-aminobenzeneboronic acid hydrochloride, boronic acid, 3-aminophenyl-, hydrochloride, pubchem1751, pubchem20396, timtec-bb sbb003816 | |
| (3-aminophenyl)boronic acid;hydrochloride |
Specifications
| 3-Aminophenylboronic acid hydrochloride | |
| Authentic | |
| White to Gray | |
| 85006-23-1 | |
| 100.0 | |
| C6H9BClNO2 | |
| 3-aminophenyl boronic acid hydrochloride, 3-aminophenylboronic acid hydrochloride, 3-aminophenylboronic acid hcl, m-aminophenylboronic acid hydrochloride, 3-aminophenylboronic acid, hcl, 3-aminobenzeneboronic acid hydrochloride, boronic acid, 3-aminophenyl-, hydrochloride, pubchem1751, pubchem20396, timtec-bb sbb003816 | |
| [H+].[Cl-].NC1=CC=CC(=C1)B(O)O | |
| 173.40 | |
| 173.41 | |
| 98% |
| 40.52 to 42.60% C, 7.88 to 8.28% N | |
| Glass bottle | |
| 5g | |
| 97.5 | |
| 98% min. (HPLC) | |
| MFCD00191748 | |
| QBMHZZHJIBUPOX-UHFFFAOYSA-N | |
| (3-aminophenyl)boronic acid;hydrochloride | |
| 2763241 | |
| Crystalline Powder |
Safety and Handling
- 3-Aminophenylboronic acid hydrochloride, 98%
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P264-Wash thoroughly after handling.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P304+P340-IF INHALED: Remove person to fresh air and keep comfortable for breathing.
- P312-Call a POISON CENTER/doctor/if you feel unwell.
- P332+P313-If skin irritation occurs: Get medical advice/attention.
- P337+P313-If eye irritation persists: Get medical advice/attention.