Learn More
Alfa Aesar™ 4,4'-Dihydroxybenzophenone, 98+%
Brand: Alfa Aesar™ A15097.06
Additional Details : CAS Number : 611-99-4 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
Applications4,4′-Dihydroxybenzophenone is as a UV light stabilizer. It and its derivatives are found in cosmetics, plastics, films, adhesives and coatings, optical fiber, and printed circuit boards. It is the precursor to certain polycarbonate polymers.
Solubility
Soluble in water(0.45g/L).
Notes
Store away from strong oxidizing agents. Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Chemical Identifiers
| 611-99-4 | |
| 214.22 | |
| RXNYJUSEXLAVNQ-UHFFFAOYSA-N | |
| 69150 | |
| bis(4-hydroxyphenyl)methanone |
| C13H10O3 | |
| MFCD00002358 | |
| 4,4'-dihydroxybenzophenone, bis 4-hydroxyphenyl methanone, hbp ketone, methanone, bis 4-hydroxyphenyl, bis 4-hydroxyphenyl ketone, 4,4'-dihydoxy-benzophenone, bis p-hydroxy benzophenone, p,p'-dihydroxybenzophenone, 4,4'-dihydroxydiphenyl ketone, benzophenone, 4,4'-dihydroxy | |
| CHEBI:34365 | |
| C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)O |
Specifications
| 4,4'-Dihydroxybenzophenone | |
| 5g | |
| C13H10O3 | |
| 1874572 | |
| Soluble in water(0.45g/L). | |
| C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)O | |
| 214.22 | |
| CHEBI:34365 | |
| ≥98% |
| 221°C to 225°C | |
| 611-99-4 | |
| MFCD00002358 | |
| 4,4'-dihydroxybenzophenone, bis 4-hydroxyphenyl methanone, hbp ketone, methanone, bis 4-hydroxyphenyl, bis 4-hydroxyphenyl ketone, 4,4'-dihydoxy-benzophenone, bis p-hydroxy benzophenone, p,p'-dihydroxybenzophenone, 4,4'-dihydroxydiphenyl ketone, benzophenone, 4,4'-dihydroxy | |
| RXNYJUSEXLAVNQ-UHFFFAOYSA-N | |
| bis(4-hydroxyphenyl)methanone | |
| 69150 | |
| 214.22 |