missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
4,5',8-Trimethylpsoralen, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63226.06
| Kvantitet | 5g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Applications4,5′,8-Trimethylpsoralen is used for treatment of psoriasis, and as a photochemical crosslinker of DNA used as a probe for nucleic acid structure, used to crosslink DNA onto mica surfaces, mutagenesis of N2 worms.
Solubility
Soluble in chloroform
Notes
Keep container tightly closed. Store away from oxidizing agents. Store in cool, dry conditions in well sealed containers.
Kemiska identifierare
| C14H12O3 | |
| MFCD00005010 | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| CHEBI:28329 | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 |
Specifikationer
| 4,5',8-Trimethylpsoralen | |
| C14H12O3 | |
| 5g | |
| 221723 | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| FMHHVULEAZTJMA-UHFFFAOYSA-N | |
| 2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one | |
| 5585 | |
| 228.25 |
| 3902-71-4 | |
| MFCD00005010 | |
| UN1759 | |
| 14,9735 | |
| Soluble in chloroform | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 | |
| 228.25 | |
| CHEBI:28329 | |
| 99% |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering