Learn More
4-Bromodiphenyl ether, 99%, ACROS Organics™
Brand: Acros Organics 106890250
Additional Details : CAS Number : 101-55-3 Weight : 0.02500kg Transport : UN number : 3082 Chem class : 9 Pack group : III
| Quantity | 25g |
|---|
Chemical Identifiers
| 101-55-3 | |
| 249.11 | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| CHEBI:77421 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
| C12H9BrO | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 7565 | |
| 1-bromo-4-phenoxybenzene |
Specifications
| 4-Bromodiphenyl ether | |
| >113°C | |
| 1.6081 | |
| 305.0°C | |
| 25g | |
| 98.5% min. (GC) | |
| BrC6H4OC6H5 | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br | |
| 249.11 | |
| CHEBI:77421 | |
| 99% |
| 1.4230g/mL | |
| Glass bottle | |
| 1.423 | |
| 18.0°C | |
| 101-55-3 | |
| C12H9BrO | |
| 06,I,105 | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 1-bromo-4-phenoxybenzene | |
| 7565 | |
| 249.11 |
Safety and Handling
- 4-Bromodiphenyl ether
Signal Word
- Danger
Hazard Category
- Acute toxicity Category 4
- LONG-TERM AQUATIC HAZARD Chronic 2
- Serious eye damage/eye irritation Category 1
- Respiratory sensitiser Category 1
Hazard Statement
- H317-May cause an allergic skin reaction.
- H318-Causes serious eye damage.
- H411-Toxic to aquatic life with long lasting effects.
- H302-Harmful if swallowed.
Precautionary Statement
- P273-Avoid release to the environment.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.