Learn More
4-Methylbenzophenone 97%, ACROS Organics™
Brand: Acros Organics 126350500
Additional Details : CAS Number : 134-84-9 Weight : 0.10000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 134-84-9 | |
| 196.25 | |
| WXPWZZHELZEVPO-UHFFFAOYSA-N | |
| 8652 | |
| CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| C14H12O | |
| MFCD00008553 | |
| 4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
| (4-methylphenyl)-phenylmethanone |
Specifications
| 50g | |
| 143°C | |
| Plastic bottle | |
| Beige to White | |
| 97% | |
| 96.0 | |
| 97% | |
| CH3C6H4COC6H5 | |
| 07, 440 | |
| 4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
| WXPWZZHELZEVPO-UHFFFAOYSA-N | |
| (4-methylphenyl)-phenylmethanone | |
| 8652 | |
| Crystalline Powder or Crystals |
| 4-Methylbenzophenone | |
| Authentic | |
| 326°C | |
| 53°C to 57°C | |
| 134-84-9 | |
| 100.0 | |
| C14H12O | |
| MFCD00008553 | |
| 14, 7317 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether and chloroform | |
| CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 | |
| 196.25 | |
| 196.25 | |
| ≥96.0% |