Learn More
4-Phenoxybenzaldehyde, 98%, ACROS Organics™
Brand: Acros Organics 198930050
Additional Details : CAS Number : 67-36-7 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 67-36-7 | |
| 198.22 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 66139 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)C=O |
| C13H10O2 | |
| MFCD00003383 | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| 4-phenoxybenzaldehyde |
Specifications
| 4-Phenoxybenzaldehyde | |
| >112°C | |
| Glass bottle | |
| 1.132 | |
| Colorless to Yellow | |
| 5g | |
| 67-36-7 | |
| 100.0 | |
| C13H10O2 | |
| MFCD00003383 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 4-phenoxybenzaldehyde | |
| 66139 | |
| Liquid After Melting |
| 1.1320g/mL | |
| Authentic | |
| 1.6100 to 1.612 | |
| 185°C (14.0mmHg) | |
| 24°C to 25°C | |
| 98% | |
| 97.5 | |
| 97.5% min. (GC) | |
| C6H5OC6H4CHO | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)C=O | |
| 198.22 | |
| 198.22 | |
| 98% |