Learn More
4-Phenylphenol 97%, ACROS Organics™
Brand: Acros Organics 158712500
Additional Details : CAS Number : 92-69-3 Weight : 0.30000kg Transport : UN number : 3077 Chem class : 9 Pack group : III
| Packaging | Plastic bottle |
|---|---|
| Quantity | 250g |
Chemical Identifiers
| 92-69-3 | |
| 170.211 | |
| YXVFYQXJAXKLAK-UHFFFAOYSA-N | |
| 7103 | |
| 4-phenylphenol |
| C12H10O | |
| MFCD00002347 | |
| 4-hydroxybiphenyl, 1,1'-biphenyl-4-ol, biphenyl-4-ol, p-phenylphenol, 4-biphenylol, p-hydroxybiphenyl, 4-hydroxydiphenyl, p-hydroxydiphenyl, p-biphenylol, 4-diphenylol | |
| CHEBI:34422 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)O |
Specifications
| 4-Phenylphenol | |
| Authentic | |
| 307.0°C | |
| >163.0°C | |
| 97% | |
| 96.0 | |
| 97% | |
| C6H5C6H4OH | |
| 4-hydroxybiphenyl, 1,1'-biphenyl-4-ol, biphenyl-4-ol, p-phenylphenol, 4-biphenylol, p-hydroxybiphenyl, 4-hydroxydiphenyl, p-hydroxydiphenyl, p-biphenylol, 4-diphenylol | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)O | |
| 170.211 | |
| CHEBI:34422 | |
| Flakes |
| 165°C | |
| Plastic bottle | |
| White to Yellow | |
| 250g | |
| 92-69-3 | |
| 100.0 | |
| C12H10O | |
| MFCD00002347 | |
| YXVFYQXJAXKLAK-UHFFFAOYSA-N | |
| 4-phenylphenol | |
| 7103 | |
| 170.21 | |
| 97% |
Safety and Handling
- 4-Phenylphenol
Signal Word
- Warning
Hazard Category
- LONG-TERM AQUATIC HAZARD Chronic 2
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H411-Toxic to aquatic life with long lasting effects.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P273-Avoid release to the environment.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.