Learn More
Norharman, 98%, Acros Organics™
Brand: Acros Organics 129265000
Additional Details : CAS Number : 244-63-3 Weight : 0.05050kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 500mg |
Chemical Identifiers
| 244-63-3 | |
| 168.2 | |
| 9h-pyrido 3,4-b indole, norharman, norharmane, beta-carboline, carbazoline, 2,9-diazafluorene, 9h-beta-carboline, 2-azacarbazole, .beta.-carboline | |
| CHEBI:109895 | |
| C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 |
| C11H8N2 | |
| AIFRHYZBTHREPW-UHFFFAOYSA-N | |
| 64961 | |
| 9H-pyrido[3,4-b]indole |
Specifications
| Norharman | |
| Glass bottle | |
| 199.0°C to 201.0°C | |
| 244-63-3 | |
| 100.0 | |
| C11H8N2 | |
| 9h-pyrido 3,4-b indole, norharman, norharmane, beta-carboline, carbazoline, 2,9-diazafluorene, 9h-beta-carboline, 2-azacarbazole, .beta.-carboline | |
| AIFRHYZBTHREPW-UHFFFAOYSA-N | |
| 9H-pyrido[3,4-b]indole | |
| 64961 | |
| 168.2 | |
| 98% |
| Authentic | |
| White to Yellow | |
| 500mg | |
| 97.5 | |
| 97.5% min. (Tertiary base) | |
| 23, II, 224 | |
| Solubility in water: insoluble. Other solubilities: soluble in methanol | |
| C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 | |
| 168.2 | |
| CHEBI:109895 | |
| Powder |