missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Aceclofenac, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J60355.06
| Kvantitet | 5g |
|---|
Se fler versioner av denna produkt
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
A non-steroidal, anti-inflammatory drug (NSAID) with potent inhibitory activity in several models of inflammation.
Kemiska identifierare
| 89796-99-6 | |
| 354.183 | |
| MNIPYSSQXLZQLJ-UHFFFAOYSA-N | |
| 71771 | |
| 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
| C16H13Cl2NO4 | |
| MFCD00864296 | |
| aceclofenac, aceclofenaco, aceclofenacum, preservex, airtal, falcol, gerbin, aceclofar, aceclofenacum latin, aceclofenaco spanish | |
| CHEBI:31159 | |
| C1=CC=C(C(=C1)CC(=O)OCC(=O)O)NC2=C(C=CC=C2Cl)Cl |
Specifikationer
| Aceclofenac | |
| C16H13Cl2NO4 | |
| UN2811 | |
| aceclofenac, aceclofenaco, aceclofenacum, preservex, airtal, falcol, gerbin, aceclofar, aceclofenacum latin, aceclofenaco spanish | |
| MNIPYSSQXLZQLJ-UHFFFAOYSA-N | |
| 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid | |
| 5g | |
| CHEBI:31159 | |
| 99% |
| 89796-99-6 | |
| MFCD00864296 | |
| 14,22 | |
| Soluble in DMSO | |
| C1=CC=C(C(=C1)CC(=O)OCC(=O)O)NC2=C(C=CC=C2Cl)Cl | |
| 354.183 | |
| 71771 | |
| 354.18 |
Produkttitel
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.
Hittar du en möjlighet till förbättring?