Learn More
Benzoin, 98%, ACROS Organics™
Brand: Acros Organics 105515000
Additional Details : CAS Number : 119-53-9 Weight : 0.55000kg
Packaging | Plastic bottle |
---|---|
Quantity | 500g |
Chemical Identifiers
119-53-9 | |
212.25 | |
ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
8400 | |
2-hydroxy-1,2-diphenylethanone |
C14H12O2 | |
MFCD00004496 | |
benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
CHEBI:17682 | |
C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O |
Specifications
Benzoin | |
1% max. | |
0.2% max. | |
White to Yellow | |
500g | |
119-53-9 | |
100.0 | |
C14H12O2 | |
MFCD00004496 | |
benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
2-hydroxy-1,2-diphenylethanone | |
8400 | |
212.25 | |
98% |
Authentic | |
Plastic bottle | |
194.0°C (12.0 mmHg) | |
133.0°C to 137.0°C | |
98% | |
97.5 | |
97.5% min. (GC) | |
C6H5CH(OH)COC6H5 | |
15, 1095 | |
Solubility in water: sparingly soluble | |
C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O | |
212.25 | |
CHEBI:17682 | |
Powder |