Learn More
Benzoin 98%, ACROS Organics™
Brand: Acros Organics 105515000
Additional Details : CAS Number : 119-53-9 Weight : 0.55000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 119-53-9 | |
| 212.248 | |
| ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
| 8400 |
| C14H12O2 | |
| MFCD00004496 | |
| α-Hydroxy-α-phenylacetophenone | |
| CHEBI:17682 |
Specifications
| Benzoin | |
| 119-53-9 | |
| 100.0 | |
| 1% max. | |
| 98% | |
| C14H12O2 | |
| MFCD00004496 | |
| 15, 1095 | |
| 194.0°C (12.0 mmHg) | |
| ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
| C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O | |
| 212.248 | |
| 8400 | |
| 212.25 |
| 98% | |
| 97.5 | |
| Authentic | |
| Plastic bottle | |
| 98% | |
| C6H5CH(OH)COC6H5 | |
| 0.2% max. | |
| α-Hydroxy-α-phenylacetophenone | |
| 133.0°C to 137.0°C | |
| White to Yellow | |
| 2-hydroxy-1,2-diphenylethanone | |
| 500g | |
| CHEBI:17682 | |
| Powder |