Learn More
Bis(2-diphenylphosphinoethyl)phenylphosphine, 97%, ACROS Organics™
Brand: Acros Organics 316820010
Additional Details : CAS Number : 23582-02-7 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 23582-02-7 | |
| 534.56 | |
| AXVOAMVQOCBPQT-UHFFFAOYSA-N | |
| 90192 | |
| C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 |
| C34H33P3 | |
| MFCD00003048 | |
| bis 2-diphenylphosphinoethyl phenylphosphine, phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine, bis 2-diphenylphosphino ethyl phenylphosphine, phosphine, bis 2-diphenylphosphino ethyl phenyl, phenylbis diphenylphosphinoethyl phosphine, pubchem6540, acmc-20alo6, chembl69711, bis 2-biphenylphosphinoethyl phenylphosphine | |
| bis(2-diphenylphosphanylethyl)-phenylphosphane |
Specifications
| 1g | |
| 74.1 to 78.7% (C) | |
| Glass bottle | |
| 121.0°C to 126.0°C | |
| 96.0 | |
| 97% | |
| MFCD00003048 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 | |
| 534.56 | |
| 534.56 | |
| 97% |
| Bis(2-diphenylphosphinoethyl)phenylphosphine | |
| Authentic | |
| White | |
| 23582-02-7 | |
| 100.0 | |
| C34H33P3 | |
| bis 2-diphenylphosphinoethyl phenylphosphine, phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine, bis 2-diphenylphosphino ethyl phenylphosphine, phosphine, bis 2-diphenylphosphino ethyl phenyl, phenylbis diphenylphosphinoethyl phosphine, pubchem6540, acmc-20alo6, chembl69711, bis 2-biphenylphosphinoethyl phenylphosphine | |
| AXVOAMVQOCBPQT-UHFFFAOYSA-N | |
| bis(2-diphenylphosphanylethyl)-phenylphosphane | |
| 90192 | |
| Powder and/or Chunks |