Learn More
Bis(2-ethylhexyl) sebacate, 97%, ACROS Organics™
Brand: Acros Organics 269920025
Additional Details : CAS Number : 122-62-3 Weight : 2.32500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 2.5L |
Chemical Identifiers
| 122-62-3 | |
| 426.67 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| bis(2-ethylhexyl) decanedioate |
| C26H50O4 | |
| VJHINFRRDQUWOJ-UHFFFAOYSA-N | |
| 31218 | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
Specifications
| -55°C | |
| 0.15mg KOH/g max. | |
| 0.9100g/mL | |
| Authentic | |
| 1.4500 to 1.455 | |
| 260 to 265mg KOH/g | |
| ca 23 mPa.s (20°C) | |
| 212°C (1.0mmHg) | |
| 122-62-3 | |
| C26H50O4 | |
| 15,1255 | |
| Solubility in water: insoluble | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC | |
| 426.67 | |
| 426.67 | |
| ≥96.0% (GC) |
| 2.5L | |
| Bis(2-ethylhexyl) sebacate | |
| 215°C | |
| Glass bottle | |
| 12% (10g, 6 hrs, 200°C) max. | |
| 0.91 | |
| 0.15% Max. (K.F.) | |
| Yellow | |
| 97% | |
| 02,181 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| VJHINFRRDQUWOJ-UHFFFAOYSA-N | |
| bis(2-ethylhexyl) decanedioate | |
| 31218 | |
| Liquid |