Learn More
Bis(2-ethylhexyl) sebacate, 97%, ACROS Organics™
Brand: Acros Organics 269920025
Additional Details : CAS Number : 122-62-3 Weight : 2.32500kg
Packaging | Glass bottle |
---|---|
Quantity | 2.5L |
Chemical Identifiers
122-62-3 | |
426.67 | |
bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
bis(2-ethylhexyl) decanedioate |
C26H50O4 | |
VJHINFRRDQUWOJ-UHFFFAOYSA-N | |
31218 | |
CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
Specifications
0.15mg KOH/g max. | |
0.9100g/mL | |
Authentic | |
1.4500 to 1.455 | |
260 to 265mg KOH/g | |
ca 23 mPa.s (20°C) | |
212°C (1.0mmHg) | |
-55°C | |
122-62-3 | |
C26H50O4 | |
15,1255 | |
Solubility in water: insoluble | |
CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC | |
426.67 | |
426.67 | |
97% |
Bis(2-ethylhexyl) sebacate | |
215°C | |
Glass bottle | |
12% (10g, 6 hrs, 200°C) max. | |
0.91 | |
0.15% Max. (K.F.) | |
Yellow | |
2.5L | |
96% min. (GC) | |
02,181 | |
bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
VJHINFRRDQUWOJ-UHFFFAOYSA-N | |
bis(2-ethylhexyl) decanedioate | |
31218 | |
Liquid |