Learn More
Bis(2-ethylhexyl) sebacate, 97%, Thermo Scientific™
Brand: Thermo Scientific Acros 269920025
Additional Details : CAS Number : 122-62-3 Weight : 2.32500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 2.5L |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 122-62-3 | |
| 426.68 | |
| VJHINFRRDQUWOJ-UHFFFAOYNA-N | |
| 31218 | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
| C26H50O4 | |
| MFCD00009497 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| bis(2-ethylhexyl) decanedioate |
Specifications
| Bis(2-ethylhexyl) sebacate | |
| 122-62-3 | |
| Yellow | |
| 212°C (1.0mmHg) | |
| 96% min. (GC) | |
| C26H50O4 | |
| 02,181 | |
| 15,1255 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| 260 to 265mg KOH/g | |
| Solubility in water: insoluble | |
| 0.91 | |
| bis(2-ethylhexyl) decanedioate | |
| 31218 | |
| Liquid | |
| ca 23 mPa.s (20°C) |
| 0.15mg KOH/g max. | |
| 0.9100g/mL | |
| -55°C | |
| 215°C | |
| Authentic | |
| MFCD00009497 | |
| Glass bottle | |
| 1.4500 to 1.455 | |
| 2.5L | |
| 12% (10g, 6 hrs, 200°C) max. | |
| VJHINFRRDQUWOJ-UHFFFAOYNA-N | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC | |
| 426.68 | |
| 426.67 | |
| 97% | |
| 0.15% Max. (K.F.) |
RUO – Research Use Only