Learn More
Bromocresol Green, sodium salt, ACROS Organics™
Brand: Acros Organics 402940050
Additional Details : CAS Number : 67763-24-0 Weight : 0.05500kg
Packaging | Glass bottle |
---|---|
Quantity | 5g |
Chemical Identifiers
67763-24-0 | |
719.996 | |
HEFSGAHJDGZCHA-UHFFFAOYSA-M | |
23675901 | |
CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)[O-])Br)Br)O)Br.[Na+] |
C21H13Br4NaO5S | |
MFCD00148898 | |
3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein sodium salt | |
sodium;2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenolate |
Specifications
Bromocresol Green, sodium salt | |
67763-24-0 | |
C21H13Br4NaO5S | |
3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein sodium salt | |
Authentic | |
sodium;2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenolate | |
23675901 | |
Powder | |
Glass bottle | |
Black to Brown-Green |
Pure | |
Passes Test | |
MFCD00148898 | |
HEFSGAHJDGZCHA-UHFFFAOYSA-M | |
CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)[O-])Br)Br)O)Br.[Na+] | |
719.996 | |
720 | |
ACS Reagent | |
from pH 3.8 (yellow) to pH 5.4 (blue) | |
5g |