Läs mer
Bupivacaine hydrochloride monohydrate, 98+%, Thermo Scientific™
Inhibits TREK-1 channels and depolarizes the cell membrane
Brand: Thermo Scientific Alfa Aesar J62835.14
| Kvantitet | 25g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsIt is employed as Na+ channel blocker, local anesthetic and cAMP production inhibitor. It acts as a surfactant molecule possessing both hydrophilic and lipophilic properties, adrenergic antagonist, EC 3.1.1.8 (cholinesterase) inhibitor and EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor.
Solubility
Soluble in water to 50 mM, in DMSO to 100 mM and in ethanol to 100 mM.
Notes
Store away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Kemiska identifierare
| 73360-54-0 | |
| 342.908 | |
| HUCIWBPMHXGLFM-UHFFFAOYSA-N | |
| 5282419 | |
| CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.O.Cl |
| C18H31ClN2O2 | |
| MFCD00078956 | |
| bupivacaine hydrochloride monohydrate, lac-43, marcaine tn, +/--1-butyl-2',6'-pipecoloxylidide monohydrochloride, monohydrate, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrate hydrochloride, bupivacaine hydrate hydrochloride, bupivacaine hcl h2-o, 2-piperidinecarboxamide, 1-butyl-n-2,6-dimethylphenyl-, monohydrochloride, monohydrate, bupivacaine hydrochloride ep, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrochloride hydrate | |
| 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrate;hydrochloride |
Specifikationer
| Bupivacaine hydrochloride monohydrate | |
| C18H31ClN2O2 | |
| 25g | |
| 14,1495 | |
| Soluble in water to 50 mM,in DMSO to 100 mM and in ethanol to 100 mM. | |
| CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.O.Cl | |
| 342.908 | |
| 342.9 |
| 73360-54-0 | |
| MFCD00078956 | |
| UN2811 | |
| bupivacaine hydrochloride monohydrate, lac-43, marcaine tn, +/--1-butyl-2',6'-pipecoloxylidide monohydrochloride, monohydrate, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrate hydrochloride, bupivacaine hydrate hydrochloride, bupivacaine hcl h2-o, 2-piperidinecarboxamide, 1-butyl-n-2,6-dimethylphenyl-, monohydrochloride, monohydrate, bupivacaine hydrochloride ep, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrochloride hydrate | |
| HUCIWBPMHXGLFM-UHFFFAOYSA-N | |
| 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrate;hydrochloride | |
| 5282419 | |
| ≥98% |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.