missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Cefmetazole sodium, 921μg/mg, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66348.03
| Kvantitet | 1g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- Cefmetazole is used to study the effect of expression, binding, and inhibition of penicillin-binding proteins (with the exception of PBP2) on bacterial cell wall mucopeptide synthesis
- It is also used to study protein mediated antibiotic tr
Kemiska identifierare
| 56796-39-5 | |
| 493.507 | |
| BITQGIOJQWZUPL-PBCQUBLHSA-M | |
| CHEBI:3490 | |
| CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC#N)OC)SC2)C(=O)[O-].[Na+] |
| C15H16N7NaO5S3 | |
| MFCD00214260 | |
| 23666711 | |
| sodium;(6R,7S)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
Specifikationer
| Cefmetazole sodium | |
| 56796-39-5 | |
| 1g | |
| C15H16N7NaO5S3 | |
| Soluble in water | |
| CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC#N)OC)SC2)C(=O)[O-].[Na+] | |
| 493.507 | |
| CHEBI:3490 |
| 921μg/mg | |
| White | |
| Hygroscopic | |
| MFCD00214260 | |
| BITQGIOJQWZUPL-PBCQUBLHSA-M | |
| sodium;(6R,7S)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | |
| 23666711 | |
| 493.52 |
Produkttitel
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.
Hittar du en möjlighet till förbättring?