Läs mer
Chlorpheniramine maleate, 99%, Thermo Scientific™
510.00 SEK - 1215.00 SEK
Kemiska identifierare
| CAS | 113-92-8 |
|---|---|
| Molekylformel | C20H23ClN2O4 |
| Molekylvikt (g/mol) | 390.86 |
| MDL-nummer | MFCD00069225 |
| InChI-nyckel | DBAKFASWICGISY-BTJKTKAUNA-N |
| Synonym | chlorpheniramine maleate, antagonate, allerclor, allergin, chlormene, alunex, carbinoxamide maleate, allergisan, -chlorpheniramine maleate salt, dl-2-p-chloro-a-2-dimethylamino ethylbenzyl pyridine bimaleate |
| PubChem CID | 5281068 |
| ChEBI | CHEBI:3645 |
| IUPAC-namn | [3-(4-chlorophenyl)-3-(pyridin-2-yl)propyl]dimethylazanium (2Z)-3-carboxyprop-2-enoate |
| LEDER | OC(=O)\C=C/C([O-])=O.C[NH+](C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1 |
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|
11411000
|
Thermo Scientific Alfa Aesar
B25238.06 |
5g |
510.00 SEK
5g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
11421000
|
Thermo Scientific Alfa Aesar
B25238.14 |
25g |
1215.00 SEK
25g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 113-92-8 | |
| 390.86 | |
| DBAKFASWICGISY-BTJKTKAUNA-N | |
| 5281068 | |
| [3-(4-chlorophenyl)-3-(pyridin-2-yl)propyl]dimethylazanium (2Z)-3-carboxyprop-2-enoate |
| C20H23ClN2O4 | |
| MFCD00069225 | |
| chlorpheniramine maleate, antagonate, allerclor, allergin, chlormene, alunex, carbinoxamide maleate, allergisan, -chlorpheniramine maleate salt, dl-2-p-chloro-a-2-dimethylamino ethylbenzyl pyridine bimaleate | |
| CHEBI:3645 | |
| OC(=O)\C=C/C([O-])=O.C[NH+](C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1 |
Specifikationer
| Chlorpheniramine maleate | |
| C20H23ClN2O4 | |
| chlorpheniramine maleate, antagonate, allerclor, allergin, chlormene, alunex, carbinoxamide maleate, allergisan, -chlorpheniramine maleate salt, dl-2-p-chloro-a-2-dimethylamino ethylbenzyl pyridine bimaleate | |
| OC(=O)\C=C/C([O-])=O.C[NH+](C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1 | |
| 390.86 | |
| CHEBI:3645 | |
| 99% |
| 113-92-8 | |
| MFCD00069225 | |
| DBAKFASWICGISY-BTJKTKAUNA-N | |
| [3-(4-chlorophenyl)-3-(pyridin-2-yl)propyl]dimethylazanium (2Z)-3-carboxyprop-2-enoate | |
| 5281068 | |
| 390.86 |
Säkerhet och hantering
GHS H Statement
H301
Toxic if swallowed.
P264b-P270-P301+P312-P330-P501c
H302
missing translation for 'einecsNumber' : 204-037-5
missing translation for 'rtecsNumber' : US6503000
missing translation for 'tsca' : Yes
Rekommenderad förvaring : Ambient temperatures
RUO – Research Use Only
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.