Learn More
D(+)-10-Camphorsulfonic acid, 99%, ACROS Organics™
Brand: Acros Organics 108225000
Additional Details : CAS Number : 3144-16-9 Weight : 0.58000kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Packaging | Plastic bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 3144-16-9 | |
| 232.294 | |
| MIOPJNTWMNEORI-GMSGAONNSA-N | |
| 65617 | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| C10H16O4S | |
| MFCD00064157 | |
| CSA | |
| CHEBI:55403 | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C |
Specifications
| D(+)-10-Camphorsulfonic acid | |
| >190.0°C | |
| 99% | |
| 20ppm max. | |
| 99% | |
| C10H16O4S | |
| 2% max. (1 g, 105°C, 5 hrs) | |
| 01,108; 02,58; 04,68; 13,62; 14,71; 16,58 | |
| CSA | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C | |
| 232.294 | |
| 65617 | |
| 232.3 | |
| + 22.00 |
| White | |
| 500g | |
| 3144-16-9 | |
| Authentic | |
| 99% | |
| MFCD00064157 | |
| 11, 315 | |
| 15, 1736 | |
| MIOPJNTWMNEORI-GMSGAONNSA-N | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid | |
| Plastic bottle | |
| CHEBI:55403 | |
| Crystalline Powder | |
| 500ppm max. |
Safety and Handling
- D(+)-10-Camphorsulfonic acid
Signal Word
- Danger
Hazard Category
- Serious eye damage/eye irritation Category 1
- Skin corrosion/irritation Category 1 B
Hazard Statement
- H318-Causes serious eye damage.
- H314-Causes severe skin burns and eye damage.
Precautionary Statement
- P260-Do not breathe dust/fume/gas/mist/vapours/spray.
- P264-Wash thoroughly after handling.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P330+P331-IF SWALLOWED: rinse mouth. Do NOT induce vomiting.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
- P310-Immediately call a POISON CENTER/doctor/.