Learn More
Thermo Scientific™ D(+)-Maltose monohydrate, 92+%
Brand: Thermo Scientific™ 329911000
Additional Details : CAS Number : 6363-53-7 Weight : 0.15000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 100g |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 6363-53-7 | |
| 360.31 | |
| HBDJFVFTHLOSDW-UHFFFAOYNA-N | |
| 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal hydrate |
| C12H24O12 | |
| MFCD00149343 | |
| d-+-maltose monohydrate, unii-dm477ee40d, 2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate, beta-maltose monohydrate, d-+-maltosemonohydrate, 69-79-4 anhydrous, d +-maltose monohydrate, d-+-maltose monohydrate, puriss., d-+-maltose monohydrate, analytical standard, d-+-maltose monohydrate, bioxtra | |
| O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O |
Specifications
| D(+)-Maltose monohydrate | |
| 6363-53-7 | |
| 130.0°C | |
| Authentic | |
| MFCD00149343 | |
| Plastic bottle | |
| d-+-maltose monohydrate, unii-dm477ee40d, 2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate, beta-maltose monohydrate, d-+-maltosemonohydrate, 69-79-4 anhydrous, d +-maltose monohydrate, d-+-maltose monohydrate, puriss., d-+-maltose monohydrate, analytical standard, d-+-maltose monohydrate, bioxtra | |
| Solubility in water: 1080g/L (20°C). Other solubilities: slightly soluble in alcohol, practically insoluble in ether | |
| O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O | |
| 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal hydrate | |
| 360.31 | |
| Crystals For Fine Crystalline Powder | |
| 92+% |
| 90% | |
| White | |
| 92% min. (HPLC) | |
| C12H24O12 | |
| 31,386 | |
| 14,5714 | |
| 100g | |
| HBDJFVFTHLOSDW-UHFFFAOYNA-N | |
| + 137.00 (20.00°C c=4,H2O,NH3) | |
| + 137.00 | |
| 360.29 | |
| 0.1% max. | |
| 7% max. |
RUO – Research Use Only