Learn More
DL-10-Camphorsulfonic acid, 98%, ACROS Organics™
Brand: Acros Organics 189075000
Additional Details : CAS Number : 5872-08-2 Weight : 0.58000kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Packaging | Plastic bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 5872-08-2 | |
| 232.29 | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| CHEBI:55379 |
| C10H16O4S | |
| MFCD00074827 | |
| 18462 |
Specifications
| 0.05 max. (20% aq. soln.) at 450nm | |
| Beige | |
| 500g | |
| (20% aq. soln.) | |
| 100ppm max. | |
| 20ppm max. | |
| 97.5 to 102.5% (on dried substance) | |
| 20ppm max. | |
| 1.5% max. (105°C) | |
| 11, 316 | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid | |
| 232.29 | |
| CHEBI:55379 | |
| Granular Powder | |
| 0.1% max. |
| DL-10-Camphorsulfonic acid | |
| >195°C | |
| 98% | |
| 5872-08-2 | |
| (20% aq. soln.) clear | |
| Authentic | |
| 98% | |
| C10H16O4S | |
| MFCD00074827 | |
| 14,71; 15,68; 16,58 | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C | |
| Plastic bottle | |
| 18462 | |
| 232.29 | |
| 500ppm max. |
Safety and Handling
- DL-10-Camphorsulfonic acid
Signal Word
- Danger
Hazard Category
- Serious eye damage/eye irritation Category 1
- Skin corrosion/irritation Category 1 B
Hazard Statement
- H318-Causes serious eye damage.
- H314-Causes severe skin burns and eye damage.
Precautionary Statement
- P260-Do not breathe dust/fume/gas/mist/vapours/spray.
- P264-Wash thoroughly after handling.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P330+P331-IF SWALLOWED: rinse mouth. Do NOT induce vomiting.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
- P310-Immediately call a POISON CENTER/doctor/.