Learn More
Dodecanedioyl dichloride, 98%, ACROS Organics™
Brand: Acros Organics 305340050
Additional Details : CAS Number : 4834-98-4 Weight : 0.05500kg Transport : UN number : 3265 Chem class : 8 Pack group : II
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 4834-98-4 | |
| 267.2 | |
| CNXXEPWXNDFGIG-UHFFFAOYSA-N | |
| 2733242 | |
| C(CCCCCC(=O)Cl)CCCCC(=O)Cl |
| C12H20Cl2O2 | |
| MFCD00012243 | |
| dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
| dodecanedioyl dichloride |
Specifications
| Dodecanedioyl dichloride | |
| >110°C | |
| Glass bottle | |
| 1.06 | |
| Yellow to Brown | |
| 98% | |
| 97.5% min. (GC) | |
| ClCO(CH2)10COCl | |
| dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
| C(CCCCCC(=O)Cl)CCCCC(=O)Cl | |
| 267.2 | |
| 267.2 | |
| 98% |
| 1.0600g/mL | |
| Authentic | |
| 1.4670 to 1.469 | |
| 140°C (0.5mmHg) | |
| 5g | |
| 4834-98-4 | |
| C12H20Cl2O2 | |
| MFCD00012243 | |
| CNXXEPWXNDFGIG-UHFFFAOYSA-N | |
| dodecanedioyl dichloride | |
| 2733242 | |
| Liquid |