Learn More
Dodecanedioyl dichloride, 98%, ACROS Organics™
Brand: Acros Organics 305340050
Additional Details : CAS Number : 4834-98-4 Weight : 0.05500kg Transport : UN number : 3265 Chem class : 8 Pack group : II
Packaging | Glass bottle |
---|---|
Quantity | 5g |
Chemical Identifiers
4834-98-4 | |
267.2 | |
CNXXEPWXNDFGIG-UHFFFAOYSA-N | |
2733242 | |
C(CCCCCC(=O)Cl)CCCCC(=O)Cl |
C12H20Cl2O2 | |
MFCD00012243 | |
dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
dodecanedioyl dichloride |
Specifications
Dodecanedioyl dichloride | |
>110°C | |
Glass bottle | |
1.06 | |
Yellow to Brown | |
98% | |
97.5% min. (GC) | |
ClCO(CH2)10COCl | |
dodecanedioyldichloride, dodecandioyldichloride, dodecanedioyl chloride, acmc-209kct, dodecanedioic acid dichloride, 1,12-dodecanedioyl dichloride, dodecanedioyl dichloride | |
C(CCCCCC(=O)Cl)CCCCC(=O)Cl | |
267.2 | |
267.2 | |
98% |
1.0600g/mL | |
Authentic | |
1.4670 to 1.469 | |
140°C (0.5mmHg) | |
5g | |
4834-98-4 | |
C12H20Cl2O2 | |
MFCD00012243 | |
CNXXEPWXNDFGIG-UHFFFAOYSA-N | |
dodecanedioyl dichloride | |
2733242 | |
Liquid |