Läs mer
Imipramine hydrochloride, Thermo Scientific™
A serotonin uptake inhibitor
Brand: Thermo Scientific Alfa Aesar J63723.06
| Kvantitet | 5g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsImipramine hydrochloride is used as a serotonin uptake inhibitor. It mainly used in the treatment of major depression and enuresis (inability to control urination). It has also been evaluated for use in panic disorder.
Solubility
Soluble in water
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Kemiska identifierare
| 113-52-0 | |
| 316.873 | |
| XZZXIYZZBJDEEP-UHFFFAOYSA-N | |
| 8228 | |
| 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride |
| C19H25ClN2 | |
| MFCD00012669 | |
| imipramine hydrochloride, imipramine hcl, tofranil, chimoreptin, chrytemin, deprinol, feinalmin, imilanyle, persamine, pertofram | |
| CHEBI:5882 | |
| CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
Specifikationer
| Imipramine hydrochloride | |
| C19H25ClN2 | |
| 5g | |
| imipramine hydrochloride, imipramine hcl, tofranil, chimoreptin, chrytemin, deprinol, feinalmin, imilanyle, persamine, pertofram | |
| XZZXIYZZBJDEEP-UHFFFAOYSA-N | |
| 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride | |
| 8228 | |
| 316.87 |
| 113-52-0 | |
| MFCD00012669 | |
| 14,4920 | |
| Soluble in water | |
| CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl | |
| 316.873 | |
| CHEBI:5882 |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.