missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Ketoprofen, Thermo Scientific™
A non-steroidal anti-inflammatory drug (NSAID); also inhibits cyclooxygenases-1 and -2
Brand: Thermo Scientific Alfa Aesar J62702.06
| Kvantitet | 5g |
|---|
Se fler versioner av denna produkt
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsIt is used as a anti-inflammatory; analgesic and an antipyretic drug cause the hypothalamus to override an interleukin-induced increase in temperature. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins.
Solubility
Slightly soluble in chloroform and methanol.
Notes
Store away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Kemiska identifierare
| 22071-15-4 | |
| 254.285 | |
| DKYWVDODHFEZIM-UHFFFAOYSA-N | |
| 3825 | |
| 2-(3-benzoylphenyl)propanoic acid |
| C16H14O3 | |
| MFCD00055790 | |
| ketoprofen, 2-3-benzoylphenyl propanoic acid, orudis, m-benzoylhydratropic acid, 2-3-benzoylphenyl propionic acid, ketoprofene, profenid, oruvail, 3-benzoylhydratropic acid, alrheumat | |
| CHEBI:6128 | |
| CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Specifikationer
| Ketoprofen | |
| C16H14O3 | |
| 5g | |
| 14,5305 | |
| Slightly soluble in chloroform and methanol. | |
| CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)O | |
| 254.285 | |
| CHEBI:6128 |
| 22071-15-4 | |
| MFCD00055790 | |
| UN2811 | |
| ketoprofen, 2-3-benzoylphenyl propanoic acid, orudis, m-benzoylhydratropic acid, 2-3-benzoylphenyl propionic acid, ketoprofene, profenid, oruvail, 3-benzoylhydratropic acid, alrheumat | |
| DKYWVDODHFEZIM-UHFFFAOYSA-N | |
| 2-(3-benzoylphenyl)propanoic acid | |
| 3825 | |
| 254.29 |
Produkttitel
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.
Hittar du en möjlighet till förbättring?