Läs mer
Nimodipine, 98+%, Thermo Scientific™
Potent L-type calcium channel antagonist
Brand: Thermo Scientific Alfa Aesar J61287.03
| Kvantitet | 1g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 66085-59-4 | |
| 418.45 | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 4497 | |
| 3-(2-methoxyethyl) 5-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| C21H26N2O7 | |
| MFCD00153848 | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| CHEBI:7575 | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C |
Specifikationer
| Nimodipine | |
| C21H26N2O7 | |
| 1g | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C | |
| 418.45 | |
| CHEBI:7575 | |
| ≥98% |
| 66085-59-4 | |
| MFCD00153848 | |
| 14,6551 | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 3-(2-methoxyethyl) 5-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | |
| 4497 | |
| 418.44 |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.