Läs mer
Nitrobenzene, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar A10585.0C
| Kvantitet | 10,000g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsNitrobenzene is used as a solvent and as a starting material in the organic synthesis for the preparation of aniline, benzidine, azobenzene, nitrosobenzene, phenylhydroxylamine and acetaminophen. It is also used as a solvent for electrophilic reagents in synthetic chemistry. Further, it is used to prevent the unpleasant odor in shoe, floor and metal polishes. It acts as a precursor to rubber chemicals, azo dyes and pharmaceuticals.
Solubility
Miscible with ethanol, diethyl ether, acetone, benzene and organic solvents. Slightly miscible with water and carbon tetrachloride.
Notes
Incompatible with strong oxidizing agents, strong reducing agents and strong bases.
Kemiska identifierare
| C6H5NO2 | |
| MFCD00007043 | |
| nitrobenzol, benzene, nitro, oil of mirbane, mirbane oil, essence of mirbane, nitro-benzene, nitrobenzeen, oil of myrbane, nitrobenzen, mononitrobenzene | |
| CHEBI:27798 | |
| C1=CC=C(C=C1)[N+](=O)[O-] |
Specifikationer
| Nitrobenzene | |
| 1.196 | |
| 87°C (188°F) | |
| 1.552 | |
| 10,000g | |
| 507540 | |
| nitrobenzol, benzene, nitro, oil of mirbane, mirbane oil, essence of mirbane, nitro-benzene, nitrobenzeen, oil of myrbane, nitrobenzen, mononitrobenzene | |
| LQNUZADURLCDLV-UHFFFAOYSA-N | |
| nitrobenzene | |
| 7416 | |
| 123.11 |
| 98-95-3 | |
| 210°C to 212°C | |
| C6H5NO2 | |
| MFCD00007043 | |
| UN1662 | |
| 14,6588 | |
| Miscible with ethanol,diethyl ether,acetone,benzene and organic solvents. Slightly miscible with water and carbon tetrachloride. | |
| C1=CC=C(C=C1)[N+](=O)[O-] | |
| 123.111 | |
| CHEBI:27798 | |
| 99% |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.