Learn More
Perfluorooctyl iodide, 98%, ACROS Organics™
Brand: Acros Organics 269960010
Additional Details : CAS Number : 507-63-1 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 507-63-1 | |
| 545.965 | |
| KWXGJTSJUKTDQU-UHFFFAOYSA-N | |
| 10491 | |
| C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| C8F17I | |
| MFCD00001064 | |
| Heptadecafluoro-1-iodooctane | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane |
Specifications
| Perfluorooctyl iodide | |
| 99% | |
| Authentic | |
| 1.3280 to 1.3310 (20°C, 589nm) | |
| Colorless to Yellow or Pink | |
| C8F17I | |
| 1g | |
| Heptadecafluoro-1-iodooctane | |
| C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F | |
| 545.965 | |
| 545.96 |
| 2.04g/mL | |
| 507-63-1 | |
| Glass bottle | |
| ≥97.5% | |
| 98% | |
| CF3(CF2)7I | |
| MFCD00001064 | |
| KWXGJTSJUKTDQU-UHFFFAOYSA-N | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane | |
| 10491 | |
| Liquid After Melting |
Safety and Handling
- Perfluorooctyl iodide
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.