Läs mer
Thermo Scientific™ (R,R)-Chloramphenicol, 98%
(R,R)-Chloramphenicol, CAS # 56-75-7, also known as chloromycetin, is a compound with broad-spectrum antibiotic and bacteriostatic activities.
Brand: Thermo Scientific™ B20841.22
| Kvantitet | 100g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
General Description
- (R,R)-chloramphenicol is a compound with antibiotic and bacteriostatic activity and is derived from Streptomyces venequelae
- It that can block the translation on the 50S subunit at the peptidyltransferase step. The binding affects the peptidyl transferase activity, preventing the transfer of amino acids to the growing peptide chains and inhibiting peptide bond formation. The resulting inhibition of the bacterial protein synthesis impedes bacterial cell proliferation
Application
- (R,R)-chloramphenicol has been used for several molecular biology approaches, mainly for bacterial selection. It can be used to select transformed cells containing chloramphenicol resistance genes
- This compound can also promote mitochondrial and chloroplast protein synthesis and the ribosomal formation of (p)ppGpp, depressing the rRNA transcription process
- In vitro results demonstrate that (R,R)-chloramphenicol shows activity against several vancomycin-resistant E. faecium strains
Kemiska identifierare
| 56-75-7 | |
| 323.126 | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 5959 | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| C11H12Cl2N2O5 | |
| MFCD00078159 | |
| Chloromycetin | |
| CHEBI:17698 | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
Specifikationer
| (R,R)-Chloramphenicol | |
| Cream to White | |
| 0.99 | |
| MFCD00078159 | |
| 14,2077 | |
| Soluble in alcohol,propylene,glycol,acetone and ethyl acetate. Slightly soluble in water. | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] | |
| 323.126 | |
| CHEBI:17698 | |
| ≥99% |
| 56-75-7 | |
| 100g | |
| C11H12Cl2N2O5 | |
| 2225532 | |
| Chloromycetin | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide | |
| 5959 | |
| 323.14 |
Säkerhet och hantering
- (R,R)-Chloramphenicol
Signalord
- Fara
Riskkategorier
- Cancerogenitet Kategorija 1B
Faroangivelser
- H350-Kan orsaka cancer.
Skyddsangivelse
- P201-Inhämta särskilda instruktioner före användning.
- P308+P313-Vid exponering eller misstanke om exponering Sök läkarhjälp.
Kompletterande information
- MIXTURE LIST-Innehåller: Chloramphenicol
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.