Learn More
Strontium nitrate, 99+%, ACS reagent, ACROS Organics™
Brand: Acros Organics 315171000
Additional Details : CAS Number : 10042-76-9 Weight : 0.15000kg Transport : UN number : 1507 Chem class : 5.1 Pack group : III
| Packaging | Plastic bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| N2O6Sr | |
| MFCD00011248 | |
| strontium nitrate, strontium dinitrate, nitric acid, strontium salt, strontium ii nitrate 1:2, unii-bdg873aqzl, nitrate de strontium french, hsdb 787, strontium nitrate sr no3 2, bdg873aqzl, nitric acid, strontium salt 2:1 | |
| strontium;dinitrate |
Specifications
| Strontium nitrate | |
| 10042-76-9 | |
| N2O6Sr | |
| MFCD00011248 | |
| strontium nitrate, strontium dinitrate, nitric acid, strontium salt, strontium ii nitrate 1:2, unii-bdg873aqzl, nitrate de strontium french, hsdb 787, strontium nitrate sr no3 2, bdg873aqzl, nitric acid, strontium salt 2:1 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium;dinitrate | |
| 211.63 | |
| 211.63 | |
| 99+% | |
| 500ppm max. | |
| 20ppm max. | |
| 5ppm max. | |
| 5ppm max. | |
| 1000ppm max. | |
| 1000ppm max. | |
| 50ppm max. | |
| 570.0°C | |
| 100g |
| 99+% | |
| 99% min. (Complexometry) | |
| Sr(NO3)2 | |
| 15,8975 | |
| Solubility in water: 660g/L (20°C). Other solubilities: slightly soluble in alcohol and acetone | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 500ppm max. | |
| 24848 | |
| Crystals | |
| ACS Reagent | |
| 20ppm max | |
| 2.99 | |
| 0.01% max | |
| 0.1% max. (105°C) | |
| Plastic bottle | |
| Solubility in water: 660g/L (20°C). Other solubilities: slightly soluble in alcohol and acetone | |
| White | |
| 5.0 to 7.0 (5% soln. at 25°C) |
Safety and Handling
- Strontium nitrate
Signal Word
- Danger
Hazard Category
- Serious eye damage/eye irritation Category 1
- Oxidising solid Category 1
Hazard Statement
- H318-Causes serious eye damage.
- H271-May cause fire or explosion; strong oxidiser.
Precautionary Statement
- P210-Keep away from heat, hot surfaces, sparks, open flames and other ignition sources. No smoking.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
- P310-Immediately call a POISON CENTER/doctor/.
- P371+P380+P375-In case of major fire and large quantities: Evacuate area Fight fire remotely due to the risk of explosion.