Learn More
Theobromine, 99%, ACROS Organics™
Brand: Acros Organics 258822500
Additional Details : CAS Number : 83-67-0 Weight : 0.30000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 250g |
Chemical Identifiers
| 83-67-0 | |
| 180.17 | |
| YAPQBXQYLJRXSA-UHFFFAOYSA-N | |
| 5429 | |
| 3,7-dimethylpurine-2,6-dione |
| C7H8N4O2 | |
| MFCD00022830 | |
| theobromine, 3,7-dimethylxanthine, diurobromine, teobromin, theosalvose, theostene, santheose, thesodate, thesal, theobromin | |
| CHEBI:28946 | |
| CN1C=NC2=C1C(=O)NC(=O)N2C |
Specifications
| Theobromine | |
| 0.5% max. (1 g, 105°C) | |
| 290.0 °C | |
| 290.0°C to 295.0°C | |
| 99% | |
| 99% | |
| MFCD00022830 | |
| 15, 9433 | |
| Solubility in water: slightly soluble. Other solubilities: moderately soluble in ammonia, practically insoluble in benzene, ether, carbon, tetrachloride and chloroform | |
| CN1C=NC2=C1C(=O)NC(=O)N2C | |
| 180.17 | |
| CHEBI:28946 | |
| Fine Powder |
| Authentic | |
| Glass bottle | |
| White | |
| 250g | |
| 83-67-0 | |
| C7H8N4O2 | |
| 26, 2336 | |
| theobromine, 3,7-dimethylxanthine, diurobromine, teobromin, theosalvose, theostene, santheose, thesodate, thesal, theobromin | |
| YAPQBXQYLJRXSA-UHFFFAOYSA-N | |
| 3,7-dimethylpurine-2,6-dione | |
| 5429 | |
| 180.17 | |
| 99% |