Learn More
Theobromine, 99%, ACROS Organics™
Brand: Acros Organics 258822500
Additional Details : CAS Number : 83-67-0 Weight : 0.30000kg
Packaging | Glass bottle |
---|---|
Quantity | 250g |
Chemical Identifiers
83-67-0 | |
180.17 | |
YAPQBXQYLJRXSA-UHFFFAOYSA-N | |
5429 | |
3,7-dimethylpurine-2,6-dione |
C7H8N4O2 | |
MFCD00022830 | |
theobromine, 3,7-dimethylxanthine, diurobromine, teobromin, theosalvose, theostene, santheose, thesodate, thesal, theobromin | |
CHEBI:28946 | |
CN1C=NC2=C1C(=O)NC(=O)N2C |
Specifications
Theobromine | |
0.5% max. (1 g, 105°C) | |
290.0 °C | |
290.0°C to 295.0°C | |
99% | |
99% | |
MFCD00022830 | |
15, 9433 | |
Solubility in water: slightly soluble. Other solubilities: moderately soluble in ammonia, practically insoluble in benzene, ether, carbon, tetrachloride and chloroform | |
CN1C=NC2=C1C(=O)NC(=O)N2C | |
180.17 | |
CHEBI:28946 | |
Fine Powder |
Authentic | |
Glass bottle | |
White | |
250g | |
83-67-0 | |
C7H8N4O2 | |
26, 2336 | |
theobromine, 3,7-dimethylxanthine, diurobromine, teobromin, theosalvose, theostene, santheose, thesodate, thesal, theobromin | |
YAPQBXQYLJRXSA-UHFFFAOYSA-N | |
3,7-dimethylpurine-2,6-dione | |
5429 | |
180.17 | |
99% |