Läs mer
Thiamphenicol, Thermo Scientific™
The methyl-sulfonyl analogue of chloramphenicol
Brand: Thermo Scientific Alfa Aesar J63575.03
| Kvantitet | 1g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsThiamphenicol is used to treat chancroid in men and uncomplicated gonorrhea. It is used in studies of bacterial protein synthesis at the level of peptidyl transferase activity associated with the 23S rRNA of the 50S ribosomal subunit. It is used to study chloraniphenicol-thiamphenicol-resistance and the use of fluorinated analogs when resistance is encountered. Its main advantage over chloramphenicol is that it has never been associated with aplastic anaemia.
Solubility
Soluble in acetonitrile or DMF. Slightly soluble in water
Notes
Research Use only: Not intended for animal or human diagnostic or therapeutic use.
Kemiska identifierare
| 15318-45-3 | |
| 356.214 | |
| OTVAEFIXJLOWRX-NXEZZACHSA-N | |
| 27200 | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| C12H15Cl2NO5S | |
| MFCD00467983 | |
| thiamphenicol, thiophenicol, thiamcol, +-thiamphenicol, raceophenidol, thiocymetin, dextrosulphenidol, thiamphenicolum, d-thiocymetin, d-thiophenicol | |
| CHEBI:32215 | |
| CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O |
Specifikationer
| Thiamphenicol | |
| C12H15Cl2NO5S | |
| 1g | |
| 14,9301 | |
| Soluble in acetonitrile or DMF; Slightly soluble in water | |
| CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O | |
| 356.214 | |
| CHEBI:32215 |
| 15318-45-3 | |
| MFCD00467983 | |
| 2819542 | |
| thiamphenicol, thiophenicol, thiamcol, +-thiamphenicol, raceophenidol, thiocymetin, dextrosulphenidol, thiamphenicolum, d-thiocymetin, d-thiophenicol | |
| OTVAEFIXJLOWRX-NXEZZACHSA-N | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | |
| 27200 | |
| 356.22 |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.