Learn More
trans-Stilbene, 96%, ACROS Organics™
trans-Stilbene, 96%, C14H12, CAS Number-103-30-0, bibenzylidine, trans-stilbene, 1,2-diphenylethylene, trans-1,2-diphenylethylene, alpha,beta-diphenylethylene, stilbene, trans-1,2-diphenylethene, bibenzal, e-stilbene, bibenzylidene, 500g, 95% min. (HPLC), 05,II,537
Brand: Acros Organics 161045000
Additional Details : CAS Number : 103-30-0 Weight : 0.58000kg Transport : UN number : 3077 Chem class : 9 Pack group : III
| Packaging | Plastic bottle |
|---|---|
| Quantity | 500g |
Description
trans-Stilbene, 96%, C14H12, CAS Number-103-30-0, bibenzylidine, trans-stilbene, 1,2-diphenylethylene, trans-1,2-diphenylethylene, alpha,beta-diphenylethylene, stilbene, trans-1,2-diphenylethene, bibenzal, e-stilbene, bibenzylidene, 500g, 95% min. (HPLC), 05,II,537
Chemical Identifiers
| 103-30-0 | |
| 180.25 | |
| PJANXHGTPQOBST-VAWYXSNFSA-N | |
| 638088 | |
| (E)-stilbene |
| C14H12 | |
| MFCD00064300 | |
| trans-stilbene, e-stilbene, stilbene, 1,2-diphenylethylene, trans-1,2-diphenylethylene, bibenzylidene, bibenzylidine, bibenzal, trans-1,2-diphenylethene, alpha,beta-diphenylethylene | |
| CHEBI:36007 | |
| C1=CC=C(C=C1)C=CC2=CC=CC=C2 |
Specifications
| trans-Stilbene | |
| Plastic bottle | |
| White to Beige | |
| 500g | |
| 103-30-0 | |
| C14H12 | |
| MFCD00064300 | |
| 15,8946 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in 90 parts cold alcohol,freely soluble in benzene and ether | |
| C1=CC=C(C=C1)C=CC2=CC=CC=C2 | |
| 180.25 | |
| CHEBI:36007 | |
| Crystals or Crystalline Powder |
| Authentic | |
| 305°C to 307°C (744.0mmHg) | |
| 122°C to 126°C | |
| 96% | |
| 95% min. (HPLC) | |
| C6H5CH=CHC6H5 | |
| 05,II,537 | |
| trans-stilbene, e-stilbene, stilbene, 1,2-diphenylethylene, trans-1,2-diphenylethylene, bibenzylidene, bibenzylidine, bibenzal, trans-1,2-diphenylethene, alpha,beta-diphenylethylene | |
| PJANXHGTPQOBST-VAWYXSNFSA-N | |
| (E)-stilbene | |
| 638088 | |
| 180.25 | |
| 96% |