Learn More
Tributyl citrate, 99+%, ACROS Organics™
Brand: Acros Organics 421442500
Additional Details : CAS Number : 77-94-1 Weight : 0.30000kg
Packaging | Glass bottle |
---|---|
Quantity | 250g |
Chemical Identifiers
77-94-1 | |
360.45 | |
ZFOZVQLOBQUTQQ-UHFFFAOYSA-N | |
6507 | |
CCCCOC(=O)CC(CC(=O)OCCCC)(C(=O)OCCCC)O |
C18H32O7 | |
MFCD00027217 | |
tributyl citrate, butyl citrate, tri-n-butyl citrate, n-butyl citrate, citroflex 4, citric acid, tributyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester, butyl citrate van, unii-827d5b1b6s, 2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester | |
tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
Specifications
0.02% max. (as citric acid) | |
1.0420g/mL | |
Authentic | |
1.4430 to 1.446 | |
31.9 mPa.s (25°C) | |
325°C | |
-20°C | |
77-94-1 | |
C18H32O7 | |
MFCD00027217 | |
tributyl citrate, butyl citrate, tri-n-butyl citrate, n-butyl citrate, citroflex 4, citric acid, tributyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester, butyl citrate van, unii-827d5b1b6s, 2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester | |
ZFOZVQLOBQUTQQ-UHFFFAOYSA-N | |
tributyl 2-hydroxypropane-1,2,3-tricarboxylate | |
6507 | |
Liquid |
Tributyl citrate | |
157°C | |
Glass bottle | |
1.042 | |
0.3% max. (K.F.) | |
Undesignated | |
250g | |
99% min. (GC) | |
HOCCOO(CH2)3CH3(CH2COO(CH2)3CH3)2 | |
15, 1565 | |
Solubility in water: insoluble. Other solubilities: miscible with most organic liquids,soluble in ethanol and ether | |
CCCCOC(=O)CC(CC(=O)OCCCC)(C(=O)OCCCC)O | |
360.45 | |
360.45 | |
99+% |