| Formel vikt |
503.26 |
| IUPAC-namn |
pentanatrium;2-[bis[2-[bis(karboxylatmetyl)amino]etyl]amino]acetat |
| InChI-nyckel |
LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Hälsofara 3 |
GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| Hälsofara 2 |
GHS H Statement Causes serious eye irritation.
|
| Hälsofara 1 |
GHS-signalord: Varning |
| Kvalitet |
Teknisk |
| PubChem CID |
8779 |
| Förpackning |
Glasflaska |
| Linjär formel |
NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
| Namnnotering |
40% Aqueous Solution |
| LEDER |
[Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| Molekylvikt (g/mol) |
503.26 |
| pH |
11.0 to 12.0 (1% aq. soln.) |
| Molekylformel |
C14H18N3Na5O10 |
| Densitet |
1.29 |
| MDL-nummer |
MFCD00051016 |
| Brytningsindex |
1.4185 to 1.4205 |
| Kokpunkt |
106°C |
| Löslighetsinformation |
Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Fysisk form |
Lösning |
| Flampunkt |
>100°C |
| Smältpunkt |
-40°C |
| CAS |
7732-18-5 |
| EINECS-nummer |
205-391-3 |
| Synonym |
pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| Kemiskt namn eller material |
Diethylenetriaminepentaacetic acid, pentasodium salt |
| Procent renhet |
39 to 41% |
| Beilstein |
04, III, 1190 |