| Densitet |
0.916 |
| Molekylformel |
C6H18NNaSi2 |
| MDL-nummer |
MFCD00009835 |
| Formel vikt |
183.38 |
| IUPAC-namn |
natrium;bis(trimetylsilyl)azanid |
| InChI-nyckel |
WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Hälsofara 3 |
GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Immediately call a POISON CENTER or doctor/physician. Avoid breathing dust/fume/gas/mist/vapors/spray. Store in a dry place. Store in a closed container. Keep container tightly closed. |
| Hälsofara 2 |
GHS P Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapor. Suspected of causing cancer. Suspected of causing genetic defects. Harmful to aquatic life with long lasting effects. Reacts violently with water. May form explosive peroxides. |
| Hälsofara 1 |
Danger |
| Fysisk form |
Vätska |
| Kvalitet |
Ren |
| Färg |
Orange till brunt |
| PubChem CID |
2724254 |
| Flampunkt |
−21°C |
| Fieser |
01,1046; 03,261; 04,442; 06,529; 12,441; 16,307 |
| Linjär formel |
[(CH3)3Si]2NNa |
| CAS |
109-99-9 |
| Namnnotering |
2M Solution in THF |
| LEDER |
C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Molekylvikt (g/mol) |
183.377 |
| EINECS-nummer |
213-983-8 |
| Synonym |
sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| TSCA |
TSCA |
| Kemiskt namn eller material |
Sodium bis(trimethylsilyl)amide |
| Procent renhet |
38 to 42% |