Filtrerade sökresultat
Di-tert-butyl dicarbonate, 99%
CAS: 24424-99-5 Molekylformel: C10H18O5 Molekylvikt (g/mol): 218.25 MDL-nummer: MFCD00008805 InChI-nyckel: DYHSDKLCOJIUFX-UHFFFAOYSA-N Synonym: di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate PubChem CID: 90495 ChEBI: CHEBI:48500 IUPAC-namn: tert-butyl-(2-metylpropan-2-yl)oxikarbonylkarbonat LEDER: CC(C)(C)OC(=O)OC(=O)OC(C)(C)C
| Molekylformel | C10H18O5 |
|---|---|
| PubChem CID | 90495 |
| MDL-nummer | MFCD00008805 |
| IUPAC-namn | tert-butyl-(2-metylpropan-2-yl)oxikarbonylkarbonat |
| CAS | 24424-99-5 |
| InChI-nyckel | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| LEDER | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| ChEBI | CHEBI:48500 |
| Molekylvikt (g/mol) | 218.25 |
| Synonym | di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate |
Benzyl bromide, 98%
CAS: 100-39-0 MDL-nummer: MFCD00000172 InChI-nyckel: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC-namn: brommetylbensen LEDER: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| MDL-nummer | MFCD00000172 |
| IUPAC-namn | brommetylbensen |
| CAS | 100-39-0 |
| InChI-nyckel | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)CBr |
| ChEBI | CHEBI:59858 |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
9-Fluorenylmethyl chloroformate, 98%
CAS: 28920-43-6 Molekylformel: C15H11ClO2 Molekylvikt (g/mol): 258.69 MDL-nummer: MFCD00001138 InChI-nyckel: IRXSLJNXXZKURP-UHFFFAOYSA-N Synonym: 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride PubChem CID: 34367 IUPAC-namn: 9H-fluoren-9-ylmetylkarbonkloridat LEDER: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl
| Molekylformel | C15H11ClO2 |
|---|---|
| PubChem CID | 34367 |
| MDL-nummer | MFCD00001138 |
| IUPAC-namn | 9H-fluoren-9-ylmetylkarbonkloridat |
| CAS | 28920-43-6 |
| InChI-nyckel | IRXSLJNXXZKURP-UHFFFAOYSA-N |
| LEDER | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl |
| Molekylvikt (g/mol) | 258.69 |
| Synonym | 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride |
Di-tert-butyldikarbonat, 1 M lösning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 24424-99-5 | C10H18O5 | 218.25 g/mol
| Molekylformel | C10H18O5 |
|---|---|
| Densitet | 0.913 |
| MDL-nummer | MFCD00008805 |
| Formel vikt | 218.25 |
| IUPAC-namn | tert-butyl-(2-metylpropan-2-yl)oxikarbonylkarbonat |
| InChI-nyckel | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest |
| ChEBI | CHEBI:48500 |
| Hälsofara 2 | GHS H Statement Highly flammable liquid and vapor. Causes serious eye damage. May cause respiratory irritation. Causes skin irritation. May cause an allergic skin reaction. Fatal if inhaled. May cause drowsiness |
| Hälsofara 1 | GHS-signalord: Fara |
| Merck Index | 15, 3038 |
| Fysisk form | Vätska |
| Färg | Färglös |
| PubChem CID | 90495 |
| Förpackning | AcroSeal™ Glasflaska |
| Flampunkt | −17°C |
| Linjär formel | O[CO2C(CH3)3]2 |
| CAS | 109-99-9 |
| Namnnotering | 1M Solution in THF |
| LEDER | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| Molekylvikt (g/mol) | 218.25 |
| EINECS-nummer | 246-240-1 |
| Synonym | di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate |
| Kemiskt namn eller material | Di-tert-butyl dicarbonate |
Klortrifenylmetan, 98 %, Thermo Scientific Chemicals
CAS: 76-83-5 Molekylformel: C19H15Cl Molekylvikt (g/mol): 278.78 MDL-nummer: MFCD00000813,MFCD00284810 InChI-nyckel: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 IUPAC-namn: [klor(difenyl)metyl]bensen LEDER: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| Molekylformel | C19H15Cl |
|---|---|
| PubChem CID | 6456 |
| MDL-nummer | MFCD00000813,MFCD00284810 |
| IUPAC-namn | [klor(difenyl)metyl]bensen |
| CAS | 76-83-5 |
| InChI-nyckel | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| LEDER | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Molekylvikt (g/mol) | 278.78 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |
Triphenylmethyl chloride, 98%
CAS: 76-83-5 Molekylformel: C19H15Cl Molekylvikt (g/mol): 278.78 MDL-nummer: MFCD00000813,MFCD00284810 InChI-nyckel: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 LEDER: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| Molekylformel | C19H15Cl |
|---|---|
| PubChem CID | 6456 |
| MDL-nummer | MFCD00000813,MFCD00284810 |
| CAS | 76-83-5 |
| InChI-nyckel | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| LEDER | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Molekylvikt (g/mol) | 278.78 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |