Läs mer
2-(2-Nitro-4-trifluoromethylbenzoyl)-1,3-cyclohexanedione, 95%, Thermo Scientific™
1630.00 SEK - 4675.00 SEK
Kemiska identifierare
| CAS | 104206-65-7 |
|---|---|
| Molekylformel | C14H10F3NO5 |
| Molekylvikt (g/mol) | 329.231 |
| MDL-nummer | MFCD01752192 |
| InChI-nyckel | OUBCNLGXQFSTLU-UHFFFAOYSA-N |
| Synonym | nitisinone, orfadin, nitisone, ntbc, 2-2-nitro-4-trifluoromethyl benzoyl cyclohexane-1,3-dione, 2-2-nitro-4-trifluoromethylbenzoyl-1,3-cyclohexanedione, nitisinone usan:inn, nitisinone inn, nitisinona |
| PubChem CID | 115355 |
| ChEBI | CHEBI:50378 |
| IUPAC-namn | 2-[2-nitro-4-(trifluoromethyl)benzoyl]cyclohexane-1,3-dione |
| LEDER | C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|
15440107
|
Thermo Scientific Alfa Aesar
H66633.MD |
250mg |
1630.00 SEK
250mg |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
15430107
|
Thermo Scientific Alfa Aesar
H66633.03 |
1g |
4675.00 SEK
1g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 104206-65-7 | |
| 329.231 | |
| OUBCNLGXQFSTLU-UHFFFAOYSA-N | |
| 115355 | |
| 2-[2-nitro-4-(trifluoromethyl)benzoyl]cyclohexane-1,3-dione |
| C14H10F3NO5 | |
| MFCD01752192 | |
| nitisinone, orfadin, nitisone, ntbc, 2-2-nitro-4-trifluoromethyl benzoyl cyclohexane-1,3-dione, 2-2-nitro-4-trifluoromethylbenzoyl-1,3-cyclohexanedione, nitisinone usan:inn, nitisinone inn, nitisinona | |
| CHEBI:50378 | |
| C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Specifikationer
| 2-(2-Nitro-4-trifluoromethylbenzoyl)-1,3-cyclohexanedione | |
| C14H10F3NO5 | |
| nitisinone, orfadin, nitisone, ntbc, 2-2-nitro-4-trifluoromethyl benzoyl cyclohexane-1,3-dione, 2-2-nitro-4-trifluoromethylbenzoyl-1,3-cyclohexanedione, nitisinone usan:inn, nitisinone inn, nitisinona | |
| C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] | |
| 329.231 | |
| CHEBI:50378 | |
| 95% |
| 104206-65-7 | |
| MFCD01752192 | |
| OUBCNLGXQFSTLU-UHFFFAOYSA-N | |
| 2-[2-nitro-4-(trifluoromethyl)benzoyl]cyclohexane-1,3-dione | |
| 115355 | |
| 329.23 |
Säkerhet och hantering
missing translation for 'rtecsNumber' : GV0766666
missing translation for 'tsca' : No
missing translation for 'storageNote' : -30° to -10°C
Rekommenderad förvaring : Store at -20°C
RUO – Research Use Only
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.