missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
5-Azacytidine, 98%, Thermo Scientific™
Causes DNA demethylation or hemi-demethylation; a powerful mutagen
Brand: Thermo Scientific Alfa Aesar J64159.06
| Kvantitet | 5g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Applications5-Azacytidine, its incorporation into RNA alters RNA synthesis and processing, and results in inhibition of protein synthesis. It has been used as a cancer chemotherapeutic agent. It is a powerful bacteriostatic, antitumor, and mutagenic agent; it also exhibits immunosuppressive, antimitotic, radioprotective, and virostatic effects.
Solubility
Soluble in water.
Notes
Store in cool, dry conditions in well sealed containers. Keep container tightly closed.
Kemiska identifierare
| 320-67-2 | |
| 244.207 | |
| NMUSYJAQQFHJEW-KVTDHHQDSA-N | |
| 9444 | |
| 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| C8H12N4O5 | |
| MFCD00006539 | |
| 5-azacytidine, azacitidine, ladakamycin, azacytidine, vidaza, mylosar, azacitidina, azacitidinum, 5-azacitidine, azacitidinum inn-latin | |
| CHEBI:2038 | |
| C1=NC(=NC(=O)N1C2C(C(C(O2)CO)O)O)N |
Specifikationer
| 5-Azacytidine | |
| C8H12N4O5 | |
| 5g | |
| 14,890 | |
| Soluble in water. | |
| C1=NC(=NC(=O)N1C2C(C(C(O2)CO)O)O)N | |
| 244.207 | |
| CHEBI:2038 | |
| 98% |
| 320-67-2 | |
| MFCD00006539 | |
| 620461 | |
| 5-azacytidine, azacitidine, ladakamycin, azacytidine, vidaza, mylosar, azacitidina, azacitidinum, 5-azacitidine, azacitidinum inn-latin | |
| NMUSYJAQQFHJEW-KVTDHHQDSA-N | |
| 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one | |
| 9444 | |
| 244.2 |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering