Läs mer
Acemetacin, Thermo Scientific™
A potent inhibitor of COX-2 found to have anti-tumor activity in the colon
Brand: Thermo Scientific Alfa Aesar J63583.04
| Kvantitet | 2g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 53164-05-9 | |
| 415.826 | |
| FSQKKOOTNAMONP-UHFFFAOYSA-N | |
| 1981 | |
| 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid |
| C21H18ClNO6 | |
| MFCD00151473 | |
| acemetacin, rantudil, emflex, acemetacinum, acemix, acemetacina, acemetacine, aximeixin, rheumibis, indomethacin carboxymethyl ester | |
| CHEBI:31162 | |
| CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(=O)O |
Specifikationer
| Acemetacin | |
| C21H18ClNO6 | |
| 2g | |
| 14,27 | |
| FSQKKOOTNAMONP-UHFFFAOYSA-N | |
| 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid | |
| 1981 | |
| 415.83 |
| 53164-05-9 | |
| MFCD00151473 | |
| UN2811 | |
| acemetacin, rantudil, emflex, acemetacinum, acemix, acemetacina, acemetacine, aximeixin, rheumibis, indomethacin carboxymethyl ester | |
| CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(=O)O | |
| 415.826 | |
| CHEBI:31162 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.