Läs mer
Aminophylline, anhydrous, 98%, Thermo Scientific™
A non-selective phosphodiesterase inhibitor
Brand: Thermo Scientific Alfa Aesar J60705.22
| Kvantitet | 100g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water. Insoluble in alcohol and ether.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Recommended storage temperature: -20°C. Keep away fom strong oxidizing agents.
Kemiska identifierare
| 317-34-0 | |
| 420.434 | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 9433 | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N |
| C16H24N10O4 | |
| MFCD00013221 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine |
Specifikationer
| Aminophylline | |
| 317-34-0 | |
| MFCD00013221 | |
| UN2811 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine | |
| 9433 | |
| 98% |
| anhydrous | |
| C16H24N10O4 | |
| 100g | |
| 14,465 | |
| Soluble in water. Insoluble in alcohol and ether. | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N | |
| 420.434 | |
| 210.21 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.