Läs mer
Amlodipine, 97+%, Thermo Scientific™
A calcium channel antagonist with potent antioxidant activity
Brand: Thermo Scientific Alfa Aesar J62242.09
| Kvantitet | 10g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in dimethyl sulfoxide, ethanol, water, dimethyl formamide, acetone, chloroform, ethyl acetate and methanol.
Notes
Incompatible with oxidizing agents.
Kemiska identifierare
| 88150-42-9 | |
| 408.88 | |
| HTIQEAQVCYTUBX-UHFFFAOYNA-N | |
| 2162 | |
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| C20H25ClN2O5 | |
| MFCD00864687 | |
| amlodipine, norvasc, amlodis, amlodipino, amlodipinum, amlocard, coroval, lipinox, amlor, amlodipinum latin | |
| CHEBI:2668 | |
| CCOC(=O)C1=C(COCCN)NC(C)=C(C1C1=CC=CC=C1Cl)C(=O)OC |
Specifikationer
| Amlodipine | |
| C20H25ClN2O5 | |
| 10g | |
| 14,491 | |
| Soluble in dimethyl sulfoxide,ethanol,water,dimethyl formamide,acetone,chloroform,ethyl acetate and methanol. | |
| CCOC(=O)C1=C(COCCN)NC(C)=C(C1C1=CC=CC=C1Cl)C(=O)OC | |
| 408.88 | |
| CHEBI:2668 | |
| ≥97% |
| 88150-42-9 | |
| MFCD00864687 | |
| UN2811 | |
| amlodipine, norvasc, amlodis, amlodipino, amlodipinum, amlocard, coroval, lipinox, amlor, amlodipinum latin | |
| HTIQEAQVCYTUBX-UHFFFAOYNA-N | |
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate | |
| 2162 | |
| 408.88 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.