Läs mer
Bethanechol chloride, 98%, Thermo Scientific™
A cholinergic receptor agonist
Brand: Thermo Scientific Alfa Aesar J65919.06
| Kvantitet | 5g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| C7H17ClN2O2 | |
| MFCD00055224 | |
| bethanechol chloride, urecholine, myocholine, besacholine, mechotane, mechothane, mecothane, myotonachol, myotonine, mictone | |
| CHEBI:3085 | |
| CC(C[N+](C)(C)C)OC(=O)N.[Cl-] |
Specifications
| Bethanechol chloride | |
| C7H17ClN2O2 | |
| 5g | |
| bethanechol chloride, urecholine, myocholine, besacholine, mechotane, mechothane, mecothane, myotonachol, myotonine, mictone | |
| CC(C[N+](C)(C)C)OC(=O)N.[Cl-] | |
| 196.675 | |
| CHEBI:3085 | |
| 98% |
| 590-63-6 | |
| MFCD00055224 | |
| 14,1185 | |
| XXRMYXBSBOVVBH-UHFFFAOYSA-N | |
| 2-carbamoyloxypropyl(trimethyl)azanium;chloride | |
| 11548 | |
| 196.68 |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.