missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Cefaclor, Thermo Scientific™
A second-generation cephalosporin antibiotic
Brand: Thermo Scientific Alfa Aesar J64252.03
| Kvantitet | 1g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsCefaclor is used to study urinary tract, intra-abdominal, and Haemophilus influenzae infections. It is used to study the mechanism of human renal organic anion and peptide transporters such as hOAT1, hPEPT1, and hPEPT2 and to study the effects of inhibition of penicillin-binding proteins on bacterial cell wall mucopeptide synthesis.
Solubility
Soluble in 1N HCl
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents.
Kemiska identifierare
| 53994-73-3 | |
| 367.804 | |
| QYIYFLOTGYLRGG-GPCCPHFNSA-N | |
| 51039 | |
| (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| C15H14ClN3O4S | |
| MFCD00151471 | |
| Panoral; (R)-3-Chloro-7-((S)-2-amino-2-phenylacetamido)-3-cephem-4-carboxylic acid | |
| CHEBI:3478 | |
| C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)Cl |
Specifikationer
| Cefaclor | |
| White to Yellow | |
| C15H14ClN3O4S | |
| 8176092 | |
| Panoral; (R)-3-Chloro-7-((S)-2-amino-2-phenylacetamido)-3-cephem-4-carboxylic acid | |
| QYIYFLOTGYLRGG-GPCCPHFNSA-N | |
| (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | |
| 51039 | |
| 367.81 |
| 53994-73-3 | |
| 1g | |
| MFCD00151471 | |
| 14,1912 | |
| Soluble in 1N HCl | |
| C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)Cl | |
| 367.804 | |
| CHEBI:3478 |
Produkttitel
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.
Hittar du en möjlighet till förbättring?