Läs mer
Chlortetracycline hydrochloride, Thermo Scientific™
Bacteriostatic antibiotic active against Gram-positive and Gram-negative bacteria
Brand: Thermo Scientific Alfa Aesar J60095.22
| Kvantitet | 100g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsChlortetracycline was used in fluorescence assays to detect the Ca+2 influx required for the completion of acrosome reaction in human spermatozoa.
Solubility
Soluble in water
Notes
Light Sensitive. Store in dark. Store away from oxidizing agent.
Kemiska identifierare
| 64-72-2 | |
| 515.34 | |
| QYAPHLRPFNSDNH-CIVPRPTRSA-N | |
| 66577600 | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl |
| C22H24Cl2N2O8 | |
| MFCD00082440 | |
| chlortetracycline hydrochloride, 4-epi-chlortetracycline hydrochloride, 2-amino hydroxy methylidene-7-chloro-4-dimethylamino-6,10,11,12a-tetrahydroxy-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride, 2-azanyl oxidanyl methylidene-7-chloranyl-4-dimethylamino-6-methyl-6,10,11,12a-tetrakis oxidanyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride | |
| (4S,4aR,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
Specifikationer
| Chlortetracycline hydrochloride | |
| C22H24Cl2N2O8 | |
| 100g | |
| Light sensitive | |
| chlortetracycline hydrochloride, 4-epi-chlortetracycline hydrochloride, 2-amino hydroxy methylidene-7-chloro-4-dimethylamino-6,10,11,12a-tetrahydroxy-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride, 2-azanyl oxidanyl methylidene-7-chloranyl-4-dimethylamino-6-methyl-6,10,11,12a-tetrakis oxidanyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride | |
| QYAPHLRPFNSDNH-CIVPRPTRSA-N | |
| (4S,4aR,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride | |
| 66577600 |
| 64-72-2 | |
| MFCD00082440 | |
| 3858364 | |
| 14,2192 | |
| Soluble in water | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl | |
| 515.34 | |
| 515.34 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.