missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Clozapine, 97%, Thermo Scientific™
Potent, selective muscarinic antagonist
Brand: Thermo Scientific Alfa Aesar J61583.MB
| Kvantitet | 25mg |
|---|
Se fler versioner av denna produkt
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| C18H19ClN4 | |
| MFCD00153785 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine |
Specifikationer
| Clozapine | |
| C18H19ClN4 | |
| 25mg | |
| 14,2423 | |
| ZUXABONWMNSFBN-UHFFFAOYSA-N | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine | |
| 2818 | |
| ≥98% |
| 5786-21-0 | |
| MFCD00153785 | |
| UN2811 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| CN1CCN(CC1)C2=C3C=CC=CC3=NC4=C(N2)C=C(C=C4)Cl | |
| 326.828 | |
| 326.83 |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering