Läs mer
Cyclosporin A, 99+%, Thermo Scientific™
Cyclosporin A, CAS # 59865-13-3, is a compound that shows immunosuppressive, antifungal, antirheumatic, and dermatologic activities. It is also a calcineurin and enzyme inhibitor.
Brand: Thermo Scientific Alfa Aesar J63191.03
| Kvantitet | 1g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 59865-13-3 | |
| 1202.64 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 132274082 | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C |
| C62H111N11O12 | |
| MFCD00274558 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone |
Specifikationer
| Cyclosporin A | |
| White | |
| C62H111N11O12 | |
| 3647785 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone | |
| 132274082 | |
| ≥99% |
| 59865-13-3 | |
| 1g | |
| MFCD00274558 | |
| 14,2752 | |
| Soluble in dimethyl sulfoxide and ethanol; Insoluble in water. | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C | |
| 1202.64 | |
| 1202.61 |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.