Läs mer
Cyclosporin A, 99+%, Thermo Scientific™
Cyclosporin A, CAS # 59865-13-3, is a compound that shows immunosuppressive, antifungal, antirheumatic, and dermatologic activities. It is also a calcineurin and enzyme inhibitor.
2785.00 SEK - 6240.00 SEK
Kemiska identifierare
| CAS | 59865-13-3 |
|---|---|
| Molekylformel | C62H111N11O12 |
| Molekylvikt (g/mol) | 1202.64 |
| MDL-nummer | MFCD00274558 |
| InChI-nyckel | PMATZTZNYRCHOR-IMVLJIQENA-N |
| Synonym | Cyclosporine A; Antibiotic S 7481F1 |
| PubChem CID | 132274082 |
| IUPAC-namn | 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone |
| LEDER | CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C |
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|
15475449
|
Thermo Scientific Alfa Aesar
J63191.03 |
1g |
2785.00 SEK
1g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
15485449
|
Thermo Scientific Alfa Aesar
J63191.06 |
5g |
6240.00 SEK
5g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 59865-13-3 | |
| 1202.64 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 132274082 | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C |
| C62H111N11O12 | |
| MFCD00274558 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone |
Specifikationer
| Cyclosporin A | |
| White | |
| MFCD00274558 | |
| 14,2752 | |
| Soluble in dimethyl sulfoxide and ethanol; Insoluble in water. | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C | |
| 1202.64 | |
| 1202.61 |
| 59865-13-3 | |
| C62H111N11O12 | |
| 3647785 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone | |
| 132274082 | |
| ≥99% |
Säkerhet och hantering
GHS H Statement
H361-H302
Suspected of damaging fertility or the unborn child.
Harmful if swallowed.
P201-P202-P264b-P270-P281-P301+P312-P308+P313-P330-P501c
H302-H350-H360FD
missing translation for 'einecsNumber' : 611-907-1
missing translation for 'rtecsNumber' : GZ4120000
missing translation for 'tsca' : No
Rekommenderad förvaring : Store at -20°C
RUO – Research Use Only
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.