Läs mer
Difloxacin hydrochloride, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63754.14
| Kvantitet | 25g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- A quinolone antibacterial compound
- Structurally related to norfloxacin
Kemiska identifierare
| 91296-86-5 | |
| 435.856 | |
| JFMGBGLSDVIOHL-UHFFFAOYSA-N | |
| 56205 | |
| CN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl |
| C21H20ClF2N3O3 | |
| MFCD03840489 | |
| difloxacin hydrochloride, difloxacin hcl, unii-xj0260hj0o, abbott-56619, 6-fluoro-1-4-fluorophenyl-7-4-methylpiperazin-1-yl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride, difloxacin hydrochloride usan, dsstox_cid_26599, dsstox_rid_81754, dsstox_gsid_46599 | |
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
Specifikationer
| Difloxacin hydrochloride | |
| C21H20ClF2N3O3 | |
| 25g | |
| 14,3141 | |
| Soluble in aqueous buffer | |
| CN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl | |
| 435.856 | |
| 435.85 |
| 91296-86-5 | |
| MFCD03840489 | |
| 6464798 | |
| difloxacin hydrochloride, difloxacin hcl, unii-xj0260hj0o, abbott-56619, 6-fluoro-1-4-fluorophenyl-7-4-methylpiperazin-1-yl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride, difloxacin hydrochloride usan, dsstox_cid_26599, dsstox_rid_81754, dsstox_gsid_46599 | |
| JFMGBGLSDVIOHL-UHFFFAOYSA-N | |
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride | |
| 56205 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.