Läs mer
Domperidone, Thermo Scientific™
Peripheral dopamine receptor antagonist that does not cross the blood-brain barrier
Brand: Thermo Scientific Alfa Aesar J63681.MC
| Kvantitet | 100mg |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsDomperidone is used as a Peripheral dopamine receptor antagonist that does not cross the blood-brain barrier. The antidopaminergic effects of Domperidone have been correlated to antiemetic and gastroprokinetic action.
Solubility
Slightly soluble in water.
Notes
Store in cool, dry conditions in well sealed containers. Keep container tightly closed.
Kemiska identifierare
| 57808-66-9 | |
| 425.917 | |
| FGXWKSZFVQUSTL-UHFFFAOYSA-N | |
| 3151 | |
| 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| C22H24ClN5O2 | |
| MFCD00069256 | |
| domperidone, motilium, nauzelin, domperidonum, domperidona, domperidon, domperidonum inn-latin, domperidona inn-spanish, motillium, motinorm | |
| CHEBI:31515 | |
| C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)CCCN4C5=CC=CC=C5NC4=O |
Specifikationer
| Domperidone | |
| C22H24ClN5O2 | |
| 100mg | |
| domperidone, motilium, nauzelin, domperidonum, domperidona, domperidon, domperidonum inn-latin, domperidona inn-spanish, motillium, motinorm | |
| FGXWKSZFVQUSTL-UHFFFAOYSA-N | |
| 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one | |
| 3151 | |
| 425.91 |
| 57808-66-9 | |
| MFCD00069256 | |
| 14,3418 | |
| Slightly soluble in water. | |
| C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)CCCN4C5=CC=CC=C5NC4=O | |
| 425.917 | |
| CHEBI:31515 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.