Läs mer
Emodin, Thermo Scientific™
A protein tyrosine kinase inhibitor
Brand: Thermo Scientific Alfa Aesar J61600.MC
| Kvantitet | 100mg |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| C15H10O5 | |
| MFCD00001207 | |
| emodin, schuttgelb, emodol, frangula emodin, rheum emodin, frangulic acid, 3-methyl-1,6,8-trihydroxyanthraquinone, archin, persian berry lake, 1,3,8-trihydroxy-6-methyl-9,10-anthraquinone | |
| CHEBI:42223 | |
| CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O |
Specifikationer
| Emodin | |
| C15H10O5 | |
| 100mg | |
| 14,3561 | |
| RHMXXJGYXNZAPX-UHFFFAOYSA-N | |
| 1,3,8-trihydroxy-6-methylanthracene-9,10-dione | |
| 3220 | |
| 270.24 |
| 518-82-1 | |
| MFCD00001207 | |
| 1888141 | |
| emodin, schuttgelb, emodol, frangula emodin, rheum emodin, frangulic acid, 3-methyl-1,6,8-trihydroxyanthraquinone, archin, persian berry lake, 1,3,8-trihydroxy-6-methyl-9,10-anthraquinone | |
| CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O | |
| 270.24 | |
| CHEBI:42223 |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.